C17H13N2O5- — CID 8858881
4-[(E)-3-(3-acetamidophenyl)-3-oxoprop-1-enyl]-2-nitrophenolate (PubChem CID 8858881) has the molecular formula C17H13N2O5- and a molecular weight of 325.30 g/mol. Its IUPAC name is 4-[(E)-3-(3-acetamidophenyl)-3-oxoprop-1-enyl]-2-nitrophenolate.
| Compound Name | 4-[(E)-3-(3-acetamidophenyl)-3-oxoprop-1-enyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 8858881 |
| Molecular Formula | C17H13N2O5- |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 4-[(E)-3-(3-acetamidophenyl)-3-oxoprop-1-enyl]-2-nitrophenolate |
| SMILES | CC(=O)Nc1cccc(C(=O)/C=C/c2ccc([O-])c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H14N2O5/c1-11(20)18-14-4-2-3-13(10-14)16(21)7-5-12-6-8-17(22)15(9-12)19(23)24/h2-10,22H,1H3,(H,18,20)/p-1/b7-5+ |
| InChIKey | RIAXZQYAWIANSU-FNORWQNLSA-M |
| XLogP | 2.52 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|