C17H15NO3 — CID 8858697
N-[3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide (PubChem CID 8858697) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | N-[3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8858697 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(=O)/C=C/c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H15NO3/c1-12(19)18-15-4-2-3-14(11-15)17(21)10-7-13-5-8-16(20)9-6-13/h2-11,20H,1H3,(H,18,19)/b10-7+ |
| InChIKey | JCQOCMUNXZEJCC-JXMROGBWSA-N |
| XLogP | 3.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|