C18H16ClNO4 — CID 8858924
N-[3-[(E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]acetamide (PubChem CID 8858924) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is N-[3-[(E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | N-[3-[(E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8858924 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-[3-[(E)-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]acetamide |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(NC(C)=O)c2)cc(Cl)c1O |
| InChI | InChI=1S/C18H16ClNO4/c1-11(21)20-14-5-3-4-13(10-14)16(22)7-6-12-8-15(19)18(23)17(9-12)24-2/h3-10,23H,1-2H3,(H,20,21)/b7-6+ |
| InChIKey | FRHSBLHVZHJTIU-VOTSOKGWSA-N |
| XLogP | 3.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|