C23H17Cl2NO4 — CID 11676588
2,6-dichloro-N-[3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]benzamide (PubChem CID 11676588) has the molecular formula C23H17Cl2NO4 and a molecular weight of 442.30 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 11676588 |
| Molecular Formula | C23H17Cl2NO4 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2,6-dichloro-N-[3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenyl]benzamide |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(NC(=O)c3c(Cl)cccc3Cl)c2)ccc1O |
| InChI | InChI=1S/C23H17Cl2NO4/c1-30-21-12-14(9-11-20(21)28)8-10-19(27)15-4-2-5-16(13-15)26-23(29)22-17(24)6-3-7-18(22)25/h2-13,28H,1H3,(H,26,29)/b10-8+ |
| InChIKey | SZSAXVSCTNSAIP-CSKARUKUSA-N |
| XLogP | 5.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|