C24H20ClNO2 — CID 7947513
2-chloro-N-[3-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]benzamide (PubChem CID 7947513) has the molecular formula C24H20ClNO2 and a molecular weight of 389.88 g/mol. Its IUPAC name is 2-chloro-N-[3-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 7947513 |
| Molecular Formula | C24H20ClNO2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-chloro-N-[3-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)/C=C/c2cccc(NC(=O)c3ccccc3Cl)c2)cc1C |
| InChI | InChI=1S/C24H20ClNO2/c1-16-10-12-19(14-17(16)2)23(27)13-11-18-6-5-7-20(15-18)26-24(28)21-8-3-4-9-22(21)25/h3-15H,1-2H3,(H,26,28)/b13-11+ |
| InChIKey | YVCKZSPSZJPJDI-ACCUITESSA-N |
| XLogP | 6.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|