C22H16ClNO5 — CID 98679351
2-chloro-N-[3-[(Z)-3-[(3S)-6-methyl-2,4-dioxopyran-3-yl]-3-oxoprop-1-enyl]phenyl]benzamide (PubChem CID 98679351) has the molecular formula C22H16ClNO5 and a molecular weight of 409.83 g/mol. Its IUPAC name is 2-chloro-N-[3-[(Z)-3-[(3S)-6-methyl-2,4-dioxopyran-3-yl]-3-oxoprop-1-enyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(Z)-3-[(3S)-6-methyl-2,4-dioxopyran-3-yl]-3-oxoprop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 98679351 |
| Molecular Formula | C22H16ClNO5 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-chloro-N-[3-[(Z)-3-[(3S)-6-methyl-2,4-dioxopyran-3-yl]-3-oxoprop-1-enyl]phenyl]benzamide |
| SMILES | CC1=CC(=O)[C@H](C(=O)/C=C\c2cccc(NC(=O)c3ccccc3Cl)c2)C(=O)O1 |
| InChI | InChI=1S/C22H16ClNO5/c1-13-11-19(26)20(22(28)29-13)18(25)10-9-14-5-4-6-15(12-14)24-21(27)16-7-2-3-8-17(16)23/h2-12,20H,1H3,(H,24,27)/b10-9-/t20-/m0/s1 |
| InChIKey | KAJDUDQVSRLDSF-QJRAZLAKSA-N |
| XLogP | 3.82 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|