C22H20ClN3O2 — CID 76877942
2-chloro-N-[3-[3-oxo-3-(1-propan-2-ylpyrazol-4-yl)prop-1-enyl]phenyl]benzamide (PubChem CID 76877942) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-chloro-N-[3-[3-oxo-3-(1-propan-2-ylpyrazol-4-yl)prop-1-enyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[3-oxo-3-(1-propan-2-ylpyrazol-4-yl)prop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 76877942 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-chloro-N-[3-[3-oxo-3-(1-propan-2-ylpyrazol-4-yl)prop-1-enyl]phenyl]benzamide |
| SMILES | CC(C)n1cc(C(=O)C=Cc2cccc(NC(=O)c3ccccc3Cl)c2)cn1 |
| InChI | InChI=1S/C22H20ClN3O2/c1-15(2)26-14-17(13-24-26)21(27)11-10-16-6-5-7-18(12-16)25-22(28)19-8-3-4-9-20(19)23/h3-15H,1-2H3,(H,25,28) |
| InChIKey | FQJUJKMLIKYIPL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|