C29H22N2O3 — CID 2832490
N-[3-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]phenyl]benzamide (PubChem CID 2832490) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[3-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]phenyl]benzamide.
| Compound Name | N-[3-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2832490 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[3-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]phenyl]benzamide |
| SMILES | O=C(C=Cc1cccc(NC(=O)c2ccccc2)c1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H22N2O3/c32-27(24-14-8-16-26(20-24)31-29(34)23-12-5-2-6-13-23)18-17-21-9-7-15-25(19-21)30-28(33)22-10-3-1-4-11-22/h1-20H,(H,30,33)(H,31,34) |
| InChIKey | IPWLHYSXJOKDFW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|