C15H12N2O3 — CID 76907802
3-[3-(pyridine-4-carbonylamino)phenyl]prop-2-enoic acid (PubChem CID 76907802) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-[3-(pyridine-4-carbonylamino)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(pyridine-4-carbonylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907802 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-[3-(pyridine-4-carbonylamino)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C15H12N2O3/c18-14(19)5-4-11-2-1-3-13(10-11)17-15(20)12-6-8-16-9-7-12/h1-10H,(H,17,20)(H,18,19) |
| InChIKey | AKNMXKHGNVOUJE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|