C18H19N3O3 — CID 139061792
(E)-3-phenylprop-2-enoic acid;N-(propan-2-ylideneamino)pyridine-4-carboxamide (PubChem CID 139061792) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (E)-3-phenylprop-2-enoic acid;N-(propan-2-ylideneamino)pyridine-4-carboxamide.
| Compound Name | (E)-3-phenylprop-2-enoic acid;N-(propan-2-ylideneamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139061792 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (E)-3-phenylprop-2-enoic acid;N-(propan-2-ylideneamino)pyridine-4-carboxamide |
| SMILES | CC(C)=NNC(=O)c1ccncc1.O=C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H11N3O.C9H8O2/c1-7(2)11-12-9(13)8-3-5-10-6-4-8;10-9(11)7-6-8-4-2-1-3-5-8/h3-6H,1-2H3,(H,12,13);1-7H,(H,10,11)/b;7-6+ |
| InChIKey | JQPHEZZITOJWBJ-UETGHTDLSA-N |
| XLogP | 2.99 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|