C26H20N6O2 — CID 46202828
N-[(E)-[(2E)-1,2-diphenyl-2-(pyridine-4-carbonylhydrazinylidene)ethylidene]amino]pyridine-4-carboxamide (PubChem CID 46202828) has the molecular formula C26H20N6O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[(E)-[(2E)-1,2-diphenyl-2-(pyridine-4-carbonylhydrazinylidene)ethylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[(2E)-1,2-diphenyl-2-(pyridine-4-carbonylhydrazinylidene)ethylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46202828 |
| Molecular Formula | C26H20N6O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[(E)-[(2E)-1,2-diphenyl-2-(pyridine-4-carbonylhydrazinylidene)ethylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C(C(=N/NC(=O)c1ccncc1)/c1ccccc1)\c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C26H20N6O2/c33-25(21-11-15-27-16-12-21)31-29-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)30-32-26(34)22-13-17-28-18-14-22/h1-18H,(H,31,33)(H,32,34)/b29-23+,30-24+ |
| InChIKey | MOFODFMUDKJYCC-HCTXVGCHSA-N |
| XLogP | 3.44 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|