C17H15N5O — CID 6236263
N-[(Z)-[2-(1H-imidazol-2-yl)-1-phenylethylidene]amino]pyridine-4-carboxamide (PubChem CID 6236263) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is N-[(Z)-[2-(1H-imidazol-2-yl)-1-phenylethylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[2-(1H-imidazol-2-yl)-1-phenylethylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6236263 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[(Z)-[2-(1H-imidazol-2-yl)-1-phenylethylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C(/Cc1ncc[nH]1)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C17H15N5O/c23-17(14-6-8-18-9-7-14)22-21-15(12-16-19-10-11-20-16)13-4-2-1-3-5-13/h1-11H,12H2,(H,19,20)(H,22,23)/b21-15- |
| InChIKey | RQBHYALYYSCIKB-QNGOZBTKSA-N |
| XLogP | 2.18 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|