C14H16N4O2 — CID 115620128
N-[2-[2-(1H-imidazol-2-yl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 115620128) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-[2-[2-(1H-imidazol-2-yl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[2-(1H-imidazol-2-yl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 115620128 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[2-[2-(1H-imidazol-2-yl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NCCc1ncc[nH]1 |
| InChI | InChI=1S/C14H16N4O2/c19-13(17-7-6-12-15-8-9-16-12)10-18-14(20)11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H,15,16)(H,17,19)(H,18,20) |
| InChIKey | HUIFCZOHEFRAQV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |