C26H32N6O6 — CID 101335616
N-[2-[[2-[4-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]butylamino]-2-oxoethyl]amino]-2-oxoethyl]benzamide (PubChem CID 101335616) has the molecular formula C26H32N6O6 and a molecular weight of 524.58 g/mol. Its IUPAC name is N-[2-[[2-[4-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]butylamino]-2-oxoethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[2-[4-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]butylamino]-2-oxoethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 101335616 |
| Molecular Formula | C26H32N6O6 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | N-[2-[[2-[4-[[2-[(2-benzamidoacetyl)amino]acetyl]amino]butylamino]-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)CNC(=O)c1ccccc1)NCCCCNC(=O)CNC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H32N6O6/c33-21(15-29-23(35)17-31-25(37)19-9-3-1-4-10-19)27-13-7-8-14-28-22(34)16-30-24(36)18-32-26(38)20-11-5-2-6-12-20/h1-6,9-12H,7-8,13-18H2,(H,27,33)(H,28,34)(H,29,35)(H,30,36)(H,31,37)(H,32,38) |
| InChIKey | BEPSEMNALVHDIR-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|