C12H15N5O2 — CID 61344378
N-[2-(3-azidopropylamino)-2-oxoethyl]benzamide (PubChem CID 61344378) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-[2-(3-azidopropylamino)-2-oxoethyl]benzamide.
| Compound Name | N-[2-(3-azidopropylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 61344378 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-[2-(3-azidopropylamino)-2-oxoethyl]benzamide |
| SMILES | [N-]=[N+]=NCCCNC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15N5O2/c13-17-16-8-4-7-14-11(18)9-15-12(19)10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,14,18)(H,15,19) |
| InChIKey | TYTRZKHKBOZPOX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|