C13H20ClN3O2 — CID 119432544
N-[2-[3-(methylamino)propylamino]-2-oxoethyl]benzamide;hydrochloride (PubChem CID 119432544) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is N-[2-[3-(methylamino)propylamino]-2-oxoethyl]benzamide;hydrochloride.
| Compound Name | N-[2-[3-(methylamino)propylamino]-2-oxoethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119432544 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[2-[3-(methylamino)propylamino]-2-oxoethyl]benzamide;hydrochloride |
| SMILES | CNCCCNC(=O)CNC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C13H19N3O2.ClH/c1-14-8-5-9-15-12(17)10-16-13(18)11-6-3-2-4-7-11;/h2-4,6-7,14H,5,8-10H2,1H3,(H,15,17)(H,16,18);1H |
| InChIKey | XDOZVHPOMZFXGO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|