C20H25N3O2 — CID 46424122
N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]benzamide (PubChem CID 46424122) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46424122 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]benzamide |
| SMILES | CN(C)c1ccc(CCCNC(=O)CNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-23(2)18-12-10-16(11-13-18)7-6-14-21-19(24)15-22-20(25)17-8-4-3-5-9-17/h3-5,8-13H,6-7,14-15H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | ZEMXUZTZOPYOJU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|