C24H30N4O3 — CID 46414564
N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 46414564) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 46414564 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[2-[3-[4-(dimethylamino)phenyl]propylamino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CN(C)c1ccc(CCCNC(=O)CNC(=O)c2ccc(N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-27(2)20-11-7-18(8-12-20)5-3-15-25-22(29)17-26-24(31)19-9-13-21(14-10-19)28-16-4-6-23(28)30/h7-14H,3-6,15-17H2,1-2H3,(H,25,29)(H,26,31) |
| InChIKey | KKUNJXVZQLIJKZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|