C18H24N4O4 — CID 9163432
N-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 9163432) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 9163432 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CCCNC(=O)CNC(=O)CNC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H24N4O4/c1-2-9-19-15(23)11-20-16(24)12-21-18(26)13-5-7-14(8-6-13)22-10-3-4-17(22)25/h5-8H,2-4,9-12H2,1H3,(H,19,23)(H,20,24)(H,21,26) |
| InChIKey | GOKYICBXWIDQEF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |