C23H25N3O5 — CID 8654014
[2-oxo-2-(2-phenylethylamino)ethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate (PubChem CID 8654014) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylethylamino)ethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate.
| Compound Name | [2-oxo-2-(2-phenylethylamino)ethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 8654014 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [2-oxo-2-(2-phenylethylamino)ethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(N2CCCC2=O)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O5/c27-20(24-13-12-17-5-2-1-3-6-17)16-31-22(29)15-25-23(30)18-8-10-19(11-9-18)26-14-4-7-21(26)28/h1-3,5-6,8-11H,4,7,12-16H2,(H,24,27)(H,25,30) |
| InChIKey | MCNVYMHVMIJPJF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |