C20H18N2O5 — CID 7952883
(2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 7952883) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7952883 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCCC2=O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O5/c23-17(21-19(25)14-5-2-1-3-6-14)13-27-20(26)15-8-10-16(11-9-15)22-12-4-7-18(22)24/h1-3,5-6,8-11H,4,7,12-13H2,(H,21,23,25) |
| InChIKey | WWJOJHWWOGINON-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |