(2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate

C20H18N2O5 — CID 7952883

IUPAC(2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate
SMILESO=C(COC(=O)c1ccc(N2CCCC2=O)cc1)NC(=O)c1ccccc1
InChIInChI=1S/C20H18N2O5/c23-17(21-19(25)14-5-2-1-3-6-14)13-27-20(26)15-8-10-16(11-9-15)22-12-4-7-18(22)24/h1-3,5-6,8-11H,4,7,12-13H2,(H,21,23,25)
InChIKeyWWJOJHWWOGINON-UHFFFAOYSA-N
MW366.37 g/mol
LogP1.93
Rot. Bonds5

About (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate

(2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 7952883) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate.

Molecular Properties

Compound Name(2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate
PubChem CID7952883
Molecular FormulaC20H18N2O5
Molecular Weight366.37 g/mol
Exact Mass366.12
IUPAC Name(2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate
SMILESO=C(COC(=O)c1ccc(N2CCCC2=O)cc1)NC(=O)c1ccccc1
InChIInChI=1S/C20H18N2O5/c23-17(21-19(25)14-5-2-1-3-6-14)13-27-20(26)15-8-10-16(11-9-15)22-12-4-7-18(22)24/h1-3,5-6,8-11H,4,7,12-13H2,(H,21,23,25)
InChIKeyWWJOJHWWOGINON-UHFFFAOYSA-N
XLogP1.93
TPSA92.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.37
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate?
The IUPAC name of (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate (CID 7952883) is (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate?
The canonical SMILES for (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate is O=C(COC(=O)c1ccc(N2CCCC2=O)cc1)NC(=O)c1ccccc1.
What is the InChIKey of (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate?
The InChIKey is WWJOJHWWOGINON-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O5/c23-17(21-19(25)14-5-2-1-3-6-14)13-27-20(26)15-8-10-16(11-9-15)22-12-4-7-18(22)24/h1-3,5-6,8-11H,4,7,12-13H2,(H,21,23,25).
What are the key properties of (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate?
(2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate has a molecular weight of 366.37 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) 4-(2-oxopyrrolidin-1-yl)benzoate is sourced from PubChem (CID 7952883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).