C19H17NO4 — CID 8648324
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] benzoate (PubChem CID 8648324) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] benzoate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] benzoate |
|---|---|
| PubChem CID | 8648324 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] benzoate |
| SMILES | O=C(COC(=O)c1ccccc1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H17NO4/c21-17(13-24-19(23)15-5-2-1-3-6-15)14-8-10-16(11-9-14)20-12-4-7-18(20)22/h1-3,5-6,8-11H,4,7,12-13H2 |
| InChIKey | YMFIPEOSTWKNHD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |