C21H17NO5 — CID 8751695
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 1-benzofuran-2-carboxylate (PubChem CID 8751695) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8751695 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 1-benzofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2o1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H17NO5/c23-17(14-7-9-16(10-8-14)22-11-3-6-20(22)24)13-26-21(25)19-12-15-4-1-2-5-18(15)27-19/h1-2,4-5,7-10,12H,3,6,11,13H2 |
| InChIKey | QEKDLYQSFCOGIY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |