C26H21NO5 — CID 46610663
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-benzo[e][1]benzofuran-1-ylacetate (PubChem CID 46610663) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-benzo[e][1]benzofuran-1-ylacetate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
|---|---|
| PubChem CID | 46610663 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
| SMILES | O=C(Cc1coc2ccc3ccccc3c12)OCC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C26H21NO5/c28-22(18-7-10-20(11-8-18)27-13-3-6-24(27)29)16-32-25(30)14-19-15-31-23-12-9-17-4-1-2-5-21(17)26(19)23/h1-2,4-5,7-12,15H,3,6,13-14,16H2 |
| InChIKey | JYJIACNZFFALKL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |