C22H18N2O6 — CID 8938877
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 8938877) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 8938877 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | O=C(CN1C(=O)C(=O)c2ccccc21)OCC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H18N2O6/c25-18(14-7-9-15(10-8-14)23-11-3-6-19(23)26)13-30-20(27)12-24-17-5-2-1-4-16(17)21(28)22(24)29/h1-2,4-5,7-10H,3,6,11-13H2 |
| InChIKey | KAJXDTOSYRAHFK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|