C20H15NO7 — CID 7804354
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804354) has the molecular formula C20H15NO7 and a molecular weight of 381.34 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804354 |
| Molecular Formula | C20H15NO7 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | O=C(CN1C(=O)C(=O)c2ccccc21)OCC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H15NO7/c22-15(12-5-6-16-17(9-12)27-8-7-26-16)11-28-18(23)10-21-14-4-2-1-3-13(14)19(24)20(21)25/h1-6,9H,7-8,10-11H2 |
| InChIKey | AHPVWDFDMXZRNW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|