C23H28N2O7 — CID 45100050
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 45100050) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 45100050 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)OCC(=O)c1ccc3c(c1)OCCO3)C2=O |
| InChI | InChI=1S/C23H28N2O7/c1-14-9-22(2,3)13-23(10-14)20(28)25(21(29)24-23)11-19(27)32-12-16(26)15-4-5-17-18(8-15)31-7-6-30-17/h4-5,8,14H,6-7,9-13H2,1-3H3,(H,24,29) |
| InChIKey | ZPDCKRRGHZRFCA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|