C26H36N4O5 — CID 46448031
3-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 46448031) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 46448031 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)N1CCN(Cc3ccc4c(c3)OCCO4)CC1)C2=O |
| InChI | InChI=1S/C26H36N4O5/c1-18-13-25(2,3)17-26(14-18)23(32)30(24(33)27-26)16-22(31)29-8-6-28(7-9-29)15-19-4-5-20-21(12-19)35-11-10-34-20/h4-5,12,18H,6-11,13-17H2,1-3H3,(H,27,33) |
| InChIKey | BXMFTJAXHIAZGN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|