C27H40N4O4 — CID 146124165
N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 146124165) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 146124165 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)NCc1ccc(CN3CC(C)OC(C)C3)cc1)C2=O |
| InChI | InChI=1S/C27H40N4O4/c1-18-10-26(4,5)17-27(11-18)24(33)31(25(34)29-27)16-23(32)28-12-21-6-8-22(9-7-21)15-30-13-19(2)35-20(3)14-30/h6-9,18-20H,10-17H2,1-5H3,(H,28,32)(H,29,34) |
| InChIKey | ABRDTIILDZPLHH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|