C20H26FN3O3 — CID 24982653
N-[(2-fluorophenyl)methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 24982653) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 24982653 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)NCc1ccccc1F)C2=O |
| InChI | InChI=1S/C20H26FN3O3/c1-13-8-19(2,3)12-20(9-13)17(26)24(18(27)23-20)11-16(25)22-10-14-6-4-5-7-15(14)21/h4-7,13H,8-12H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | LZLMLBUTOCPABR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|