C21H29FN2O4 — CID 17412187
3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 17412187) has the molecular formula C21H29FN2O4 and a molecular weight of 392.47 g/mol. Its IUPAC name is 3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 17412187 |
| Molecular Formula | C21H29FN2O4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(O)COCc1ccccc1F)C2=O |
| InChI | InChI=1S/C21H29FN2O4/c1-14-8-20(2,3)13-21(9-14)18(26)24(19(27)23-21)10-16(25)12-28-11-15-6-4-5-7-17(15)22/h4-7,14,16,25H,8-13H2,1-3H3,(H,23,27) |
| InChIKey | MUNTWGZPNIUVTQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|