C18H22FNO4 — CID 18087078
2-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 18087078) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 18087078 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCCC2)C(=O)N1CC(O)COCc1ccccc1F |
| InChI | InChI=1S/C18H22FNO4/c19-15-6-2-1-5-13(15)11-24-12-14(21)10-20-16(22)9-18(17(20)23)7-3-4-8-18/h1-2,5-6,14,21H,3-4,7-12H2 |
| InChIKey | KVLFNOVQPQITKE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|