C18H21Cl2NO4 — CID 75858651
2-[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 75858651) has the molecular formula C18H21Cl2NO4 and a molecular weight of 386.28 g/mol. Its IUPAC name is 2-[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | 2-[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 75858651 |
| Molecular Formula | C18H21Cl2NO4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | O=C1CC2(CCCCC2)C(=O)N1CC(O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H21Cl2NO4/c19-13-5-4-6-14(20)16(13)25-11-12(22)10-21-15(23)9-18(17(21)24)7-2-1-3-8-18/h4-6,12,22H,1-3,7-11H2 |
| InChIKey | VRBRPQLMYOSNFJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|