C20H27NO4 — CID 18087097
2-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 18087097) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | 2-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 18087097 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | Cc1ccc(C)c(OCC(O)CN2C(=O)CC3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C20H27NO4/c1-14-6-7-15(2)17(10-14)25-13-16(22)12-21-18(23)11-20(19(21)24)8-4-3-5-9-20/h6-7,10,16,22H,3-5,8-9,11-13H2,1-2H3 |
| InChIKey | VBYVLJWBBBRWAT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|