C19H25NO4 — CID 31579986
2-[(2S)-3-(2,4-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 31579986) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[(2S)-3-(2,4-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[(2S)-3-(2,4-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 31579986 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[(2S)-3-(2,4-dimethylphenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | Cc1ccc(OC[C@@H](O)CN2C(=O)CC3(CCCC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C19H25NO4/c1-13-5-6-16(14(2)9-13)24-12-15(21)11-20-17(22)10-19(18(20)23)7-3-4-8-19/h5-6,9,15,21H,3-4,7-8,10-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | HGCHGEIGOHYUKA-HNNXBMFYSA-N |
| XLogP | 2.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|