C17H21NO4S — CID 94802700
(5S)-2-[(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 94802700) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is (5S)-2-[(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | (5S)-2-[(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 94802700 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (5S)-2-[(2S)-2-hydroxy-3-(3-methylphenoxy)propyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | Cc1cccc(OC[C@@H](O)CN2C(=O)C[C@]3(CCSC3)C2=O)c1 |
| InChI | InChI=1S/C17H21NO4S/c1-12-3-2-4-14(7-12)22-10-13(19)9-18-15(20)8-17(16(18)21)5-6-23-11-17/h2-4,7,13,19H,5-6,8-11H2,1H3/t13-,17-/m0/s1 |
| InChIKey | ZKQZPMQDZCFCEI-GUYCJALGSA-N |
| XLogP | 1.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|