C15H18N2O4S — CID 31574475
(5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 31574475) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is (5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 31574475 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1N[C@]2(CCSC2)C(=O)N1C[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C15H18N2O4S/c18-11(9-21-12-4-2-1-3-5-12)8-17-13(19)15(16-14(17)20)6-7-22-10-15/h1-5,11,18H,6-10H2,(H,16,20)/t11-,15+/m1/s1 |
| InChIKey | IXUYFPKIRPFBRI-ABAIWWIYSA-N |
| XLogP | 0.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|