C19H23N3O4 — CID 18086925
4-[3-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-2-hydroxypropoxy]benzonitrile (PubChem CID 18086925) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[3-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[3-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 18086925 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[3-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-2-hydroxypropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)CN2C(=O)NC3(CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H23N3O4/c20-11-14-5-7-16(8-6-14)26-13-15(23)12-22-17(24)19(21-18(22)25)9-3-1-2-4-10-19/h5-8,15,23H,1-4,9-10,12-13H2,(H,21,25) |
| InChIKey | ZTTNNBZVQVMNRZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|