C17H19N3O4 — CID 18086907
4-[3-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]benzonitrile (PubChem CID 18086907) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-[3-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[3-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 18086907 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-[3-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]benzonitrile |
| SMILES | CC1(C2CC2)NC(=O)N(CC(O)COc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C17H19N3O4/c1-17(12-4-5-12)15(22)20(16(23)19-17)9-13(21)10-24-14-6-2-11(8-18)3-7-14/h2-3,6-7,12-13,21H,4-5,9-10H2,1H3,(H,19,23) |
| InChIKey | DDTIWGYNTGLZBC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|