C22H23N3O4 — CID 70126090
4-[4-[2-hydroxy-3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]benzonitrile (PubChem CID 70126090) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[4-[2-hydroxy-3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-hydroxy-3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 70126090 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-[4-[2-hydroxy-3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]benzonitrile |
| SMILES | CN1C(=O)N(CC(O)COc2ccc(-c3ccc(C#N)cc3)cc2)C(C)(C)C1=O |
| InChI | InChI=1S/C22H23N3O4/c1-22(2)20(27)24(3)21(28)25(22)13-18(26)14-29-19-10-8-17(9-11-19)16-6-4-15(12-23)5-7-16/h4-11,18,26H,13-14H2,1-3H3 |
| InChIKey | YLJSXBKGFPPDOE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|