C16H22N2O2 — CID 92983492
4-[(2S)-2-hydroxy-3-[(2S)-2-methylpiperidin-1-yl]propoxy]benzonitrile (PubChem CID 92983492) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-[(2S)-2-hydroxy-3-[(2S)-2-methylpiperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[(2S)-2-hydroxy-3-[(2S)-2-methylpiperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 92983492 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-[(2S)-2-hydroxy-3-[(2S)-2-methylpiperidin-1-yl]propoxy]benzonitrile |
| SMILES | C[C@H]1CCCCN1C[C@H](O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-13-4-2-3-9-18(13)11-15(19)12-20-16-7-5-14(10-17)6-8-16/h5-8,13,15,19H,2-4,9,11-12H2,1H3/t13-,15-/m0/s1 |
| InChIKey | NOPBLNOQYPRZFG-ZFWWWQNUSA-N |
| XLogP | 2.17 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |