C17H24N2O2 — CID 100836371
2-[4-[(2R)-2-hydroxy-3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]acetonitrile (PubChem CID 100836371) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[4-[(2R)-2-hydroxy-3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[(2R)-2-hydroxy-3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 100836371 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[4-[(2R)-2-hydroxy-3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]acetonitrile |
| SMILES | C[C@@H]1CCCCN1C[C@@H](O)COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C17H24N2O2/c1-14-4-2-3-11-19(14)12-16(20)13-21-17-7-5-15(6-8-17)9-10-18/h5-8,14,16,20H,2-4,9,11-13H2,1H3/t14-,16-/m1/s1 |
| InChIKey | FCJPDUPEEJMVJP-GDBMZVCRSA-N |
| XLogP | 2.37 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |