C21H19F2N3O5 — CID 55410147
4-[3-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzonitrile (PubChem CID 55410147) has the molecular formula C21H19F2N3O5 and a molecular weight of 431.40 g/mol. Its IUPAC name is 4-[3-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[3-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 55410147 |
| Molecular Formula | C21H19F2N3O5 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-[3-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]benzonitrile |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(CC(O)COc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C21H19F2N3O5/c1-21(14-4-8-17(9-5-14)31-19(22)23)18(28)26(20(29)25-21)11-15(27)12-30-16-6-2-13(10-24)3-7-16/h2-9,15,19,27H,11-12H2,1H3,(H,25,29) |
| InChIKey | QZBVUVIIXNJMRW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|