C20H19ClF2N2O5 — CID 46796671
3-[3-(4-chlorophenoxy)-2-hydroxypropyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 46796671) has the molecular formula C20H19ClF2N2O5 and a molecular weight of 440.83 g/mol. Its IUPAC name is 3-[3-(4-chlorophenoxy)-2-hydroxypropyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(4-chlorophenoxy)-2-hydroxypropyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46796671 |
| Molecular Formula | C20H19ClF2N2O5 |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-[3-(4-chlorophenoxy)-2-hydroxypropyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(CC(O)COc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H19ClF2N2O5/c1-20(12-2-6-16(7-3-12)30-18(22)23)17(27)25(19(28)24-20)10-14(26)11-29-15-8-4-13(21)5-9-15/h2-9,14,18,26H,10-11H2,1H3,(H,24,28) |
| InChIKey | VKMAETQATSXGHC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|