C18H19ClN2O5 — CID 51222955
5-(4-chlorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 51222955) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51222955 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(Cl)cc2)NC(=O)N(CC(O)COCc2ccco2)C1=O |
| InChI | InChI=1S/C18H19ClN2O5/c1-18(12-4-6-13(19)7-5-12)16(23)21(17(24)20-18)9-14(22)10-25-11-15-3-2-8-26-15/h2-8,14,22H,9-11H2,1H3,(H,20,24) |
| InChIKey | MGQYVIXQJCIFCI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|