C19H22N2O5 — CID 31571010
(5S)-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 31571010) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (5S)-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31571010 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (5S)-3-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(C[C@H](O)COCc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C19H22N2O5/c1-13-5-7-14(8-6-13)19(2)17(23)21(18(24)20-19)10-15(22)11-25-12-16-4-3-9-26-16/h3-9,15,22H,10-12H2,1-2H3,(H,20,24)/t15-,19-/m0/s1 |
| InChIKey | NAQNAAUIHRNSSV-KXBFYZLASA-N |
| XLogP | 1.93 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|