C18H18F2N2O5 — CID 51250426
5-(3,4-difluorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 51250426) has the molecular formula C18H18F2N2O5 and a molecular weight of 380.35 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(3,4-difluorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51250426 |
| Molecular Formula | C18H18F2N2O5 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(CC(O)COCc2ccco2)C1=O |
| InChI | InChI=1S/C18H18F2N2O5/c1-18(11-4-5-14(19)15(20)7-11)16(24)22(17(25)21-18)8-12(23)9-26-10-13-3-2-6-27-13/h2-7,12,23H,8-10H2,1H3,(H,21,25) |
| InChIKey | ZKXQDVQUKAAGDE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|