C12H12F2N2O2 — CID 92799825
(5S)-5-(3,4-difluorophenyl)-3-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 92799825) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is (5S)-5-(3,4-difluorophenyl)-3-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3,4-difluorophenyl)-3-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92799825 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (5S)-5-(3,4-difluorophenyl)-3-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N[C@@](C)(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C12H12F2N2O2/c1-3-16-10(17)12(2,15-11(16)18)7-4-5-8(13)9(14)6-7/h4-6H,3H2,1-2H3,(H,15,18)/t12-/m0/s1 |
| InChIKey | YLFVSBOZYOWGQU-LBPRGKRZSA-N |
| XLogP | 1.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|