C19H15F2N3O3 — CID 46641129
4-[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile (PubChem CID 46641129) has the molecular formula C19H15F2N3O3 and a molecular weight of 371.34 g/mol. Its IUPAC name is 4-[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 46641129 |
| Molecular Formula | C19H15F2N3O3 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]benzonitrile |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(CCOc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C19H15F2N3O3/c1-19(13-4-7-15(20)16(21)10-13)17(25)24(18(26)23-19)8-9-27-14-5-2-12(11-22)3-6-14/h2-7,10H,8-9H2,1H3,(H,23,26) |
| InChIKey | DGKRCYANBRNORR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|