C14H15N3O2 — CID 40972073
4-[(4S)-4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl]benzonitrile (PubChem CID 40972073) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-[(4S)-4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl]benzonitrile.
| Compound Name | 4-[(4S)-4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 40972073 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[(4S)-4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl]benzonitrile |
| SMILES | CCCN1C(=O)N[C@@](C)(c2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C14H15N3O2/c1-3-8-17-12(18)14(2,16-13(17)19)11-6-4-10(9-15)5-7-11/h4-7H,3,8H2,1-2H3,(H,16,19)/t14-/m0/s1 |
| InChIKey | PVUUVLKKCRDISW-AWEZNQCLSA-N |
| XLogP | 1.74 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|